| Primary information |
|---|
| Hemolytik ID | 2964 |
| PMID | 21955251 |
| YEAR | 2011 |
| SEQUENCE | GIIKKI |
| LENGTH | 6 |
| NAME | G(IIKK)I |
| C-ter Modification | Amidation |
| N-ter Modification | Free |
| Linear/Cyclic | Linear |
| Stereochemistry | L |
| Modified Residues | None |
| FUNCTION | Antimicrobial and Antitumor |
| ACTIVITY | Non-hemolytic up to 250μM |
| RBCs SOURCE | Human |
| Secondary information |
|---|
| Properties | Physico-Chemical details |
| STRUCTURE | |
| DSSP states | CCCCCC |
| SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)O |
| External Links |
|---|
| PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
| NA |
NA |
NA |
NA |
NA |
E6L5Y6 from 210 TO 215 |
NA |
NA |
|
| Reference Informaiton |
|---|
| ARTICLE | Designed antimicrobial and antitumor peptides with high selectivity. |
| AUTHORS | Hu J,Chen C,Zhang S,Zhao X,Xu H,Zhao X |
| JOURNAL | Biomacromolecules. 2011 Nov 14;12(11):3839-43. doi: 10.1021/bm201098j. Epub 2011 Oct 3. |