Primary information |
---|
Hemolytik ID | 2964 |
PMID | 21955251 |
YEAR | 2011 |
SEQUENCE | GIIKKI |
LENGTH | 6 |
NAME | G(IIKK)I |
C-ter Modification | Amidation |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | L |
Modified Residues | None |
FUNCTION | Antimicrobial and Antitumor |
ACTIVITY | Non-hemolytic up to 250μM |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CCCCCC |
SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
NA |
NA |
NA |
E6L5Y6 from 210 TO 215 |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Designed antimicrobial and antitumor peptides with high selectivity. |
AUTHORS | Hu J,Chen C,Zhang S,Zhao X,Xu H,Zhao X |
JOURNAL | Biomacromolecules. 2011 Nov 14;12(11):3839-43. doi: 10.1021/bm201098j. Epub 2011 Oct 3. |