| Primary information |
|---|
| Hemolytik ID | 2873 |
| PMID | 21335383 |
| YEAR | 2011 |
| SEQUENCE | kklfkkILKYL |
| LENGTH | 11 |
| NAME | BP164 |
| C-ter Modification | Amidation |
| N-ter Modification | Free |
| Linear/Cyclic | Linear |
| Stereochemistry | Mix (Contains both L and D amino acids) |
| Modified Residues | None |
| FUNCTION | Antimicrobial |
| ACTIVITY | 0±0% hemolytic at 250μM (non-hemolytic) |
| RBCs SOURCE | Human |
| Secondary information |
|---|
| Properties | Physico-Chemical details |
| STRUCTURE | |
| DSSP states | CTHHHHHHHHC |
| SMILES | N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)O |
| External Links |
|---|
| PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
| NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
| Reference Informaiton |
|---|
| ARTICLE | Improvement of the efficacy of linear undecapeptides against plant-pathogenic bacteria by incorporation of D-amino acids. |
| AUTHORS | Guell I,Cabrefiga J,Badosa E,Ferre R,Talleda M,Bardaji E,Planas M,Feliu L |
| JOURNAL | Appl Environ Microbiol. 2011 Apr;77(8):2667-75. doi: 10.1128/AEM.02759-10. Epub 2011 Feb 18. |