| Primary information |
|---|
| Hemolytik ID | 2709 |
| PMID | 22371493 |
| YEAR | 2012 |
| SEQUENCE | GIIKVIKSLIEQFTGK |
| LENGTH | 16 |
| NAME | dPSMα1 |
| C-ter Modification | Free |
| N-ter Modification | Free |
| Linear/Cyclic | Linear |
| Stereochemistry | L |
| Modified Residues | None |
| FUNCTION | Immunosuppressive and Antimicrobial |
| ACTIVITY | Non-hemolytic at 10μg/mL |
| RBCs SOURCE | Human |
| Secondary information |
|---|
| Properties | Physico-Chemical details |
| STRUCTURE | |
| DSSP states | CHHHHHTHHHHGGGCC |
| SMILES | NCC(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H]([C@@H](C)O)C(=O)NCC(=O)N[C@@H](CCCCN)C(=O)O |
| External Links |
|---|
| PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
| NA |
NA |
NA |
P0C7X8 from 6 TO 21 |
NA |
G7ZRU2 from 6 TO 21 |
NA |
NA |
|
| Reference Informaiton |
|---|
| ARTICLE | Novel phenol-soluble modulin derivatives in community-associated methicillin-resistant Staphylococcus aureus identified through imaging mass spectrometry. |
| AUTHORS | Gonzalez DJ,Okumura CY,Hollands A,Kersten R,Akong-Moore K,Pence MA,Malone CL,Derieux J,Moore BS,Horswill AR,Dixon JE,Dorrestein PC |
| JOURNAL | J Biol Chem. 2012 Apr 20;287(17):13889-98. doi: 10.1074/jbc.M112.349860. Epub 2012 Feb 27. |