Primary information |
---|
Hemolytik ID | 2437 |
PMID | 10795591 |
YEAR | 2000 |
SEQUENCE | rggrlcycrrrfcvcvgr |
LENGTH | 18 |
NAME | dPG-1 |
C-ter Modification | Amidation |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | D |
Modified Residues | None |
FUNCTION | Antimicrobial |
ACTIVITY | 90% hemolysis at 80µg/ml |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CCSCCSCCCCCSCCCCCC |
SMILES | N[C@@H](CCCN=C)C(=O)NCC(=O)NCC(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)NCC(=O)N[C@@H](CCCN=C)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
1pg1A |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Evaluation of the inactivation of infectious Herpes simplex virus by host-defense peptides. |
AUTHORS | Yasin B,Pang M,Turner JS,Cho Y,Dinh NN,Waring AJ,Lehrer RI |
JOURNAL | Eur J Clin Microbiol Infect Dis. 2000 Mar;19(3):187-94. |