Primary information |
---|
Hemolytik ID | 1927 |
PMID | 17961502 |
YEAR | 2008 |
SEQUENCE | FKRLEKLFSKIQNDK |
LENGTH | 16 |
NAME | HPN2(6–20) |
C-ter Modification | Free |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | L |
Modified Residues | None |
FUNCTION | Antimicrobial |
ACTIVITY | 0% hemolysis at 100µM (non-hemolytic) |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CHHHHHHHCTTTTCC |
SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CO)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H]([C@@H](C)CC)C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CC(=O)N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CCCCN)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
1p0gA from 5 TO 19 |
NA |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Amphipathic alpha-helical peptide, HP (2-20), and its analogues derived from Helicobacter pylori: pore formation mechanism in various lipid compositions. |
AUTHORS | Park SC,Kim MH,Hossain MA,Shin SY,Kim Y,Stella L,Wade JD,Park Y |
JOURNAL | Biochim Biophys Acta. 2008 Jan;1778(1):229-41. Epub 2007 Oct 2. |