Primary information |
---|
Hemolytik ID | 1577 |
PMID | 14733952 |
YEAR | 2004 |
SEQUENCE | KWKKLLKKLLpLLKKLLK |
LENGTH | 18 |
NAME | KLW-K11p |
C-ter Modification | Amidation |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | Mix (Contains both L and D amino acids) |
Modified Residues | None |
FUNCTION | Antimicrobial |
ACTIVITY | >30% hemolysisat 100µM |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CHHHHHHHHHHHHHHHTC |
SMILES | N[C@@H](CCCCN)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Effects of L- or D-Pro incorporation into hydrophobic or hydrophilic helix face of amphipathic alpha-helical model peptide on structure and cell selectivity. |
AUTHORS | Song YM,Yang ST,Lim SS,Kim Y,Hahm KS,Kim JI |
JOURNAL | Biochem Biophys Res Commun. 2004 Feb 6;314(2):615-21. |