Primary information |
---|
Hemolytik ID | 1394 |
PMID | 19544481 |
YEAR | 2009 |
SEQUENCE | LLKWLKKL |
LENGTH | 8 |
NAME | L4K3W4 |
C-ter Modification | Amidation |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | L |
Modified Residues | None |
FUNCTION | Antimicrobial |
ACTIVITY | 5.01% hemolysis at 200μg/ml |
RBCs SOURCE | Human |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CCGGGTCC |
SMILES | N[C@@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CC(C)C)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | De novo generation of antimicrobial LK peptides with a single tryptophan at the critical amphipathic interface. |
AUTHORS | Kang SJ,Won HS,Choi WS |
JOURNAL | J Pept Sci. 2009 Sep;15(9):583-8. doi: 10.1002/psc.1149. |