| Primary information |
|---|
| Hemolytik ID | 1362 |
| PMID | 19445503 |
| YEAR | 2009 |
| SEQUENCE | WVLVLRlGY |
| LENGTH | 9 |
| NAME | dVVRG |
| C-ter Modification | Free |
| N-ter Modification | Free |
| Linear/Cyclic | Linear |
| Stereochemistry | Mix (Contains both L and D amino acids) |
| Modified Residues | None |
| FUNCTION | Antimicrobial |
| ACTIVITY | 12±13% hemolysis at 15μM |
| RBCs SOURCE | Human |
| Secondary information |
|---|
| Properties | Physico-Chemical details |
| STRUCTURE | |
| DSSP states | CCSSCCCCC |
| SMILES | N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CC(C)C)C(=O)NCC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| External Links |
|---|
| PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
| NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
| Reference Informaiton |
|---|
| ARTICLE | Broad-spectrum antimicrobial peptides by rational combinatorial design and high-throughput screening: the importance of interfacial activity. |
| AUTHORS | Rathinakumar R, Walkenhorst, William ,Walkenhorst WF |
| JOURNAL | J Am Chem Soc. 2009 Jun 10;131(22):7609-17. doi: 10.1021/ja8093247. |