| Primary information |
|---|
| Hemolytik ID | 1190 |
| PMID | 18455267 |
| YEAR | 2008 |
| SEQUENCE | CYCFRRFCVC |
| LENGTH | 10 |
| NAME | PC74 |
| C-ter Modification | Free |
| N-ter Modification | Free |
| Linear/Cyclic | Linear |
| Stereochemistry | L |
| Modified Residues | None |
| FUNCTION | Antimicrobial |
| ACTIVITY | 0-3% hemolysis at 80μg/ml |
| RBCs SOURCE | Human |
| Secondary information |
|---|
| Properties | Physico-Chemical details |
| STRUCTURE | |
| DSSP states | CTTTTSSSCC |
| SMILES | N[C@@H](CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CS)C(=O)O |
| External Links |
|---|
| PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
| NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
| Reference Informaiton |
|---|
| ARTICLE | Correlation between simulated physicochemical properties and hemolycity of protegrin-like antimicrobial peptides: predicting experimental toxicity. |
| AUTHORS | Langham AA,Khandelia H,Schuster B,Waring AJ,Lehrer RI |
| JOURNAL | Peptides. 2008 Jul;29(7):1085-93. doi: 10.1016/j.peptides.2008.03.018. Epub 2008 Mar 28. |