Primary information |
---|
Hemolytik ID | 1079 |
PMID | 17145799 |
YEAR | 2007 |
SEQUENCE | RWRWRW |
LENGTH | 6 |
NAME | (RW)3 |
C-ter Modification | Amidation |
N-ter Modification | Free |
Linear/Cyclic | Linear |
Stereochemistry | L |
Modified Residues | None |
FUNCTION | Antimicrobial |
ACTIVITY | HD50=2.1x102μM |
RBCs SOURCE | Sheep |
Secondary information |
---|
Properties | Physico-Chemical details |
STRUCTURE | |
DSSP states | CCCCCC |
SMILES | N[C@@H](CCCN=C)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)N[C@@H](CCCN=C)C(=O)N[C@@H](Cc1c[nH]c(C)c1CC)C(=O)O |
External Links |
---|
PDB exact | PDB partial | SP exact | SP partial | TrEMBL exact | TrEMBL partial | IEDB exact | IEDB partial |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
NA |
|
Reference Informaiton |
---|
ARTICLE | Length effects in antimicrobial peptides of the (RW)n series. |
AUTHORS | Liu Z,Brady A,Young A,Rasimick B,Chen K,Zhou C |
JOURNAL | Antimicrob Agents Chemother. 2007 Feb;51(2):597-603. Epub 2006 Dec 4. |